Number |
qtl-m1625 |
Declustering Potential(DP) |
|
Collision Energy(CE) |
|
Observed mass(Da) |
|
Exact mass(Da) |
|
Accurate mass error(ppm) |
|
Molecular formula |
|
Ionization model |
|
Ret. Time(min) |
|
Precursor ions(Q1) |
348.4 |
Product ions(Q3) |
109.1 |
Main fragments |
|
Compound |
Tianshic acid |
Identification |
putative |
class |
Fatty acid |
Organism |
|
Reference |
|
CV(%) |
|
H2 |
|
ChEBI_ID |
CHEBI:66230 |
Agricola Citation Links |
|
ArrayExpress Database Links |
|
BRAND Names |
|
Beilstein Registry Numbers |
|
BioModels Database Links |
|
CAS Registry Numbers |
|
COMe Database Links |
|
ChEBI ID |
|
ChEBI Name |
tianshic acid;; |
Charge |
0;; |
Chinese Abstracts Citation Links |
470504;;344523;; |
CiteXplore Citation Links |
|
Definition |
An olefinic fatty acid that is (9E)-octadec-9-enoic acid substituted by hydroxy groups at positions 8, 11 and 12. It has been isolated from Allium fistulosum and Ophiopogon japonicus.;; |
DrugBank Database Links |
|
Formulae |
C18H34O5;; |
Gmelin Registry Numbers |
|
INN |
|
IUPAC Names |
(9E)-8,11,12-trihydroxyoctadec-9-enoic acid;; |
InChI |
InChI=1S/C18H34O5/c1-2-3-4-8-11-16(20)17(21)14-13-15(19)10-7-5-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13+;; |
InChIKey |
YFCZLXRIKFCQFU-BUHFOSPRSA-N;; |
IntAct Database Links |
|
IntEnz Database Links |
|
KEGG COMPOUND Database Links |
|
KEGG DRUG Database Links |
|
KEGG GLYCAN Database Links |
|
LIPID MAPS class Database Links |
|
LIPID MAPS instance Database Links |
|
Last Modified |
09 Jun 2016;; |
Mass |
330.45960;; |
MolBase Database Links |
|
PDBeChem Database Links |
|
Patent Database Links |
|
PubChem Database Links |
160710108;; |
PubMed Central Citation Links |
|
PubMed Citation Links |
23186307;;18619265;;16651764;;12381110;; |
RESID Database Links |
|
Reactome Database Links |
|
Rhea Database Links |
|
SABIO-RK Database Links |
|
SMILES |
CCCCCCC(O)C(O)\C=C\C(O)CCCCCCC(O)=O;; |
Secondary ChEBI ID |
|
Star |
3;; |
Synonyms |
|
UM-BBD compID Database Links |
|
UniProt Database Links |
|
ChEBI Image |
|
|
|