| Number |
qtl-m1622 |
| Declustering Potential(DP) |
|
| Collision Energy(CE) |
|
| Observed mass(Da) |
|
| Exact mass(Da) |
|
| Accurate mass error(ppm) |
|
| Molecular formula |
|
| Ionization model |
|
| Ret. Time(min) |
|
| Precursor ions(Q1) |
348 |
| Product ions(Q3) |
136 |
| Main fragments |
|
| Compound |
Adenosine 3'-monophosphate |
| Identification |
putative |
| class |
|
| Organism |
|
| Reference |
|
| CV(%) |
|
| H2 |
|
| ChEBI_ID |
CHEBI:28931 |
| Agricola Citation Links |
|
| ArrayExpress Database Links |
|
| BRAND Names |
|
| Beilstein Registry Numbers |
54478;; |
| BioModels Database Links |
|
| CAS Registry Numbers |
|
| COMe Database Links |
|
| ChEBI ID |
|
| ChEBI Name |
3'-AMP;; |
| Charge |
0;; |
| Chinese Abstracts Citation Links |
|
| CiteXplore Citation Links |
|
| Definition |
An adenosine 3'-phosphate with a monophosphate group at the 3'-position.;; |
| DrugBank Database Links |
|
| Formulae |
C10H14N5O7P;; |
| Gmelin Registry Numbers |
905125;; |
| INN |
|
| IUPAC Names |
3'-adenylic acid;; |
| InChI |
InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(17)7(4(1-16)21-10)22-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1;; |
| InChIKey |
LNQVTSROQXJCDD-KQYNXXCUSA-N;; |
| IntAct Database Links |
EBI-1778575;; |
| IntEnz Database Links |
|
| KEGG COMPOUND Database Links |
|
| KEGG DRUG Database Links |
|
| KEGG GLYCAN Database Links |
|
| LIPID MAPS class Database Links |
|
| LIPID MAPS instance Database Links |
|
| Last Modified |
25 Jan 2016;; |
| Mass |
347.22142;; |
| MolBase Database Links |
|
| PDBeChem Database Links |
3AM;; |
| Patent Database Links |
EP1547577;; |
| PubChem Database Links |
11533209;; |
| PubMed Central Citation Links |
|
| PubMed Citation Links |
23759508;;21622827;;18544912;; |
| RESID Database Links |
|
| Reactome Database Links |
|
| Rhea Database Links |
|
| SABIO-RK Database Links |
7822;;3322;;305;; |
| SMILES |
Nc1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](OP(O)(O)=O)[C@H]1O;; |
| Secondary ChEBI ID |
CHEBI:22241;;CHEBI:1333;;CHEBI:40872;; |
| Star |
3;; |
| Synonyms |
{[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy}phosphonic acid;;synadenylic acid;;adenosine 3'-monophosphate;;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-methylol-tetrahydrofuran-3-yl] dihydrogen phosphate;;[(2R, |
| UM-BBD compID Database Links |
|
| UniProt Database Links |
Q9Z1N4;;Q9Z0S1;;Q9M0Y6;;Q9KJX5;;Q8ZBP9;;Q8Z153;;Q8XCG6;;Q8RWA5;;Q8GY63;;Q8FAG5;;Q8D2P7;;Q869K3;;Q84VY5;;Q83JY2;;Q7N8K4;;Q7M456;;Q7M438;;Q66EC0;;Q61LC0;;Q5PEG4;;Q5BCG1;;Q59XQ1;;Q59544;;Q58247;;Q57KJ7;;Q55F34;;Q42546;;Q3ZCK3;;Q3YYB8;;Q38945;;Q32CI6;;Q31XA6; |
| ChEBI Image |
 |
| |
|
