| |
| Number |
qtl-m1491 |
| Declustering Potential(DP) |
|
| Collision Energy(CE) |
|
| Observed mass(Da) |
|
| Exact mass(Da) |
|
| Accurate mass error(ppm) |
|
| Molecular formula |
|
| Ionization model |
|
| Ret. Time(min) |
|
| Precursor ions(Q1) |
317.2 |
| Product ions(Q3) |
173.1 |
| Main fragments |
|
| Compound |
Phytocassane D |
| Identification |
putative |
| class |
Terpene |
| Organism |
|
| Reference |
|
| CV(%) |
|
| H2 |
|
| ChEBI_ID |
CHEBI:72669 |
| Agricola Citation Links |
|
| ArrayExpress Database Links |
|
| BRAND Names |
|
| Beilstein Registry Numbers |
|
| BioModels Database Links |
|
| CAS Registry Numbers |
|
| COMe Database Links |
|
| ChEBI ID |
|
| ChEBI Name |
(+)-phytocassane D;; |
| Charge |
0;; |
| Chinese Abstracts Citation Links |
|
| CiteXplore Citation Links |
|
| Definition |
A diterpenoid that is podocarp-12-ene-2,11-dione carrying additional hydroxy, vinyl and methyl substituents at positions 1, 12 and 13 respectively.;; |
| DrugBank Database Links |
|
| Formulae |
C20H28O3;; |
| Gmelin Registry Numbers |
|
| INN |
|
| IUPAC Names |
(2R,4aS,4bS,8R,8aS,10aR)-7-ethenyl-2-hydroxy-1,1,4a,8-tetramethyl-1,4a,4b,8,8a,9,10,10a-octahydrophenanthrene-3,5(2H,4H)-dione;; |
| InChI |
InChI=1S/C20H28O3/c1-6-12-9-14(21)17-13(11(12)2)7-8-16-19(3,4)18(23)15(22)10-20(16,17)5/h6,9,11,13,16-18,23H,1,7-8,10H2,2-5H3/t11-,13-,16-,17+,18-,20-/m0/s1;; |
| InChIKey |
DGUIKAVSMBLZCL-HHDROYBHSA-N;; |
| IntAct Database Links |
|
| IntEnz Database Links |
|
| KEGG COMPOUND Database Links |
|
| KEGG DRUG Database Links |
|
| KEGG GLYCAN Database Links |
|
| LIPID MAPS class Database Links |
|
| LIPID MAPS instance Database Links |
|
| Last Modified |
01 Mar 2013;; |
| Mass |
316.43450;; |
| MolBase Database Links |
|
| PDBeChem Database Links |
|
| Patent Database Links |
|
| PubChem Database Links |
162012236;; |
| PubMed Central Citation Links |
|
| PubMed Citation Links |
|
| RESID Database Links |
|
| Reactome Database Links |
|
| Rhea Database Links |
|
| SABIO-RK Database Links |
|
| SMILES |
[H][C@@]12CC[C@@]3([H])C(C)(C)[C@@H](O)C(=O)C[C@]3(C)[C@@]1([H])C(=O)C=C(C=C)[C@@H]2C;; |
| Secondary ChEBI ID |
|
| Star |
3;; |
| Synonyms |
phytocassane D;;(2R,4aS,4bS,8R,8aS,10aR)-2-hydroxy-1,1,4a,8-tetramethyl-7-vinyl-1,4a,4b,8,8a,9,10,10a-octahydrophenanthrene-3,5(2H,4H)-dione;; |
| UM-BBD compID Database Links |
|
| UniProt Database Links |
|
| ChEBI Image |
 |
| |
|
|
|
|
