Number |
qtl-m1412 |
Declustering Potential(DP) |
|
Collision Energy(CE) |
|
Observed mass(Da) |
|
Exact mass(Da) |
|
Accurate mass error(ppm) |
|
Molecular formula |
|
Ionization model |
|
Ret. Time(min) |
|
Precursor ions(Q1) |
295.2 |
Product ions(Q3) |
179.2 |
Main fragments |
|
Compound |
9-Hydroxy-(10E,12Z,15Z)-octadecatrienoic acid |
Identification |
putative |
class |
Fatty acid |
Organism |
|
Reference |
|
CV(%) |
|
H2 |
|
ChEBI_ID |
CHEBI:72625 |
Agricola Citation Links |
|
ArrayExpress Database Links |
|
BRAND Names |
|
Beilstein Registry Numbers |
|
BioModels Database Links |
|
CAS Registry Numbers |
|
COMe Database Links |
|
ChEBI ID |
|
ChEBI Name |
9-HOTrE;; |
Charge |
0;; |
Chinese Abstracts Citation Links |
|
CiteXplore Citation Links |
|
Definition |
A hydroxyoctadecatrienoic acid that consists of 10E,12Z,15Z-octadecatrienoic acid bearing an additional 9-hydroxy substituent.;; |
DrugBank Database Links |
|
Formulae |
C18H30O3;; |
Gmelin Registry Numbers |
|
INN |
|
IUPAC Names |
(10E,12Z,15Z)-9-hydroxyoctadeca-10,12,15-trienoic acid;; |
InChI |
InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h3-4,6,8,11,14,17,19H,2,5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b4-3-,8-6-,14-11+;; |
InChIKey |
RIGGEAZDTKMXSI-CUHSZNQNSA-N;; |
IntAct Database Links |
|
IntEnz Database Links |
|
KEGG COMPOUND Database Links |
|
KEGG DRUG Database Links |
|
KEGG GLYCAN Database Links |
|
LIPID MAPS class Database Links |
|
LIPID MAPS instance Database Links |
|
Last Modified |
08 Jun 2016;; |
Mass |
294.42900;; |
MolBase Database Links |
|
PDBeChem Database Links |
|
Patent Database Links |
|
PubChem Database Links |
162012163;; |
PubMed Central Citation Links |
|
PubMed Citation Links |
|
RESID Database Links |
|
Reactome Database Links |
|
Rhea Database Links |
|
SABIO-RK Database Links |
|
SMILES |
CC\C=C/C\C=C/C=C/C(O)CCCCCCCC(O)=O;; |
Secondary ChEBI ID |
|
Star |
3;; |
Synonyms |
9-hydroxy-10E,12Z,15Z-octadecatrienoic acid;; |
UM-BBD compID Database Links |
|
UniProt Database Links |
|
ChEBI Image |
|
|
|