| Number |
qtl-m1083 |
| Declustering Potential(DP) |
|
| Collision Energy(CE) |
|
| Observed mass(Da) |
|
| Exact mass(Da) |
|
| Accurate mass error(ppm) |
|
| Molecular formula |
|
| Ionization model |
|
| Ret. Time(min) |
|
| Precursor ions(Q1) |
130.1 |
| Product ions(Q3) |
84.2 |
| Main fragments |
|
| Compound |
1-Amino-1-cyclopentanecarboxylic acid |
| Identification |
putative |
| class |
|
| Organism |
|
| Reference |
|
| CV(%) |
|
| H2 |
|
| ChEBI_ID |
CHEBI:40547 |
| Agricola Citation Links |
|
| ArrayExpress Database Links |
|
| BRAND Names |
|
| Beilstein Registry Numbers |
|
| BioModels Database Links |
|
| CAS Registry Numbers |
52-52-8;; |
| COMe Database Links |
|
| ChEBI ID |
|
| ChEBI Name |
1-aminocyclopentanecarboxylic acid;; |
| Charge |
0;; |
| Chinese Abstracts Citation Links |
|
| CiteXplore Citation Links |
|
| Definition |
A non-proteinogenic alpha-amino acid that is cyclopentane substituted at position 1 by amino and carboxy groups.;; |
| DrugBank Database Links |
DB04620;; |
| Formulae |
C6H11NO2;; |
| Gmelin Registry Numbers |
|
| INN |
|
| IUPAC Names |
1-aminocyclopentane-1-carboxylic acid;; |
| InChI |
InChI=1S/C6H11NO2/c7-6(5(8)9)3-1-2-4-6/h1-4,7H2,(H,8,9);; |
| InChIKey |
NILQLFBWTXNUOE-UHFFFAOYSA-N;; |
| IntAct Database Links |
|
| IntEnz Database Links |
|
| KEGG COMPOUND Database Links |
C03969 |
| KEGG DRUG Database Links |
|
| KEGG GLYCAN Database Links |
|
| LIPID MAPS class Database Links |
|
| LIPID MAPS instance Database Links |
|
| Last Modified |
02 Mar 2016;; |
| Mass |
129.15700;; |
| MolBase Database Links |
|
| PDBeChem Database Links |
AC5;; |
| Patent Database Links |
|
| PubChem Database Links |
223442533;; |
| PubMed Central Citation Links |
|
| PubMed Citation Links |
970113;;956827;;624950;;6028026;;5703023;;5673450;;22402366;;15747318;;13983935;;13916973;;13880910;; |
| RESID Database Links |
|
| Reactome Database Links |
|
| Rhea Database Links |
|
| SABIO-RK Database Links |
|
| SMILES |
NC1(CCCC1)C(O)=O;; |
| Secondary ChEBI ID |
|
| Star |
3;; |
| Synonyms |
Cycloleucine;;Cycloleucin;;Cyclo-leucine;;ACPC;;1-Aminocyclopentanecarboxylic acid;;1-Aminocyclopentane-1-carboxylic acid;;1-Amino-1-cyclopentanecarboxylic acid;;1-Amino-1-carboxycyclopentane;;1-AMINOCYCLOPENTANECARBOXYLIC ACID;; |
| UM-BBD compID Database Links |
|
| UniProt Database Links |
|
| ChEBI Image |
 |
| |
|
