| Number |
qtl-m1072 |
| Declustering Potential(DP) |
|
| Collision Energy(CE) |
|
| Observed mass(Da) |
|
| Exact mass(Da) |
|
| Accurate mass error(ppm) |
|
| Molecular formula |
|
| Ionization model |
|
| Ret. Time(min) |
|
| Precursor ions(Q1) |
120.1 |
| Product ions(Q3) |
73.9 |
| Main fragments |
|
| Compound |
L-Homoserine |
| Identification |
putative |
| class |
Amino acid |
| Organism |
|
| Reference |
|
| CV(%) |
|
| H2 |
|
| ChEBI_ID |
CHEBI:15699 |
| Agricola Citation Links |
|
| ArrayExpress Database Links |
|
| BRAND Names |
|
| Beilstein Registry Numbers |
1721681;; |
| BioModels Database Links |
BIOMD0000000497;;BIOMD0000000496;;BIOMD0000000473;;BIOMD0000000472;;BIOMD0000000471;;BIOMD0000000470;;BIOMD0000000469;;BIOMD0000000212;;BIOMD0000000068;;BIOMD0000000066;; |
| CAS Registry Numbers |
672-15-1;; |
| COMe Database Links |
|
| ChEBI ID |
|
| ChEBI Name |
L-homoserine;; |
| Charge |
0;; |
| Chinese Abstracts Citation Links |
|
| CiteXplore Citation Links |
|
| Definition |
The L-enantiomer of homoserine.;; |
| DrugBank Database Links |
DB04193;; |
| Formulae |
C4H9NO3;; |
| Gmelin Registry Numbers |
|
| INN |
|
| IUPAC Names |
L-homoserine;; |
| InChI |
InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1;; |
| InChIKey |
UKAUYVFTDYCKQA-VKHMYHEASA-N;; |
| IntAct Database Links |
|
| IntEnz Database Links |
|
| KEGG COMPOUND Database Links |
|
| KEGG DRUG Database Links |
|
| KEGG GLYCAN Database Links |
|
| LIPID MAPS class Database Links |
|
| LIPID MAPS instance Database Links |
|
| Last Modified |
17 Jun 2016;; |
| Mass |
119.11920;; |
| MolBase Database Links |
|
| PDBeChem Database Links |
|
| Patent Database Links |
WO2006014429;;WO2006004433;;EP1422218;; |
| PubChem Database Links |
8143376;; |
| PubMed Central Citation Links |
|
| PubMed Citation Links |
7067099;;22770225;;20669995;;2026685;;19212411;;12027520;;11683513;; |
| RESID Database Links |
|
| Reactome Database Links |
|
| Rhea Database Links |
|
| SABIO-RK Database Links |
1868;;1866;; |
| SMILES |
N[C@@H](CCO)C(O)=O;; |
| Secondary ChEBI ID |
CHEBI:21330;;CHEBI:13123;;CHEBI:6246;;CHEBI:43131;; |
| Star |
3;; |
| Synonyms |
Homoserine;;2-Amino-4-hydroxybutyrate;;2-Amino-4-hydroxybutanoic acid;;2-Amino-4-hydroxybutanoate;;2-Amino-4-hydroxy-L-Butyric acid;;2-Amino-4-hydroxy-L-Butyrate;;2-Amino-4-hydroxy-Butyric acid;;2-Amino-4-hydroxy-Butyrate;;(S)-Homoserine;;(S)-2-amino-4-hy |
| UM-BBD compID Database Links |
|
| UniProt Database Links |
Q9ZMX5;;Q9ZMW7;;Q9ZM48;;Q9ZL20;;Q9ZK28;;Q9ZJZ7;;Q9ZDL2;;Q9ZCI7;;Q9Z6L0;;Q9YA72;;Q9Y875;;Q9WZY3;;Q9WZ15;;Q9UZV7;;Q9SSP5;;Q9SA18;;Q9S7B5;;Q9S702;;Q9RVZ8;;Q9RRU5;;Q9RAM6;;Q9RA51;;Q9PLV2;;Q9PK32;;Q9PIZ3;;Q9PBC0;;Q9PAN0;;Q9MT28;;Q9LYU8;;Q9L8R8;;Q9L6N6;;Q9KRM5; |
| ChEBI Image |
 |
| |
|
