| Number |
qtl-m0164 |
| Declustering Potential(DP) |
60 |
| Collision Energy(CE) |
50 |
| Observed mass(Da) |
271.0601 |
| Exact mass(Da) |
271.0601 |
| Accurate mass error(ppm) |
0 |
| Molecular formula |
C15H10O5 |
| Ionization model |
|
| Ret. Time(min) |
|
| Precursor ions(Q1) |
271.1 |
| Product ions(Q3) |
153.1 |
| Main fragments |
153.1, 243.2, 229.1, 197.2, 145.2, 119.1 |
| Compound |
Apigenin |
| Identification |
standard |
| class |
Flavonoid |
| Organism |
|
| Reference |
|
| CV(%) |
|
| H2 |
|
| ChEBI_ID |
CHEBI:18388 |
| Agricola Citation Links |
|
| ArrayExpress Database Links |
|
| BRAND Names |
|
| Beilstein Registry Numbers |
262620;; |
| BioModels Database Links |
|
| CAS Registry Numbers |
|
| COMe Database Links |
|
| ChEBI ID |
|
| ChEBI Name |
apigenin;; |
| Charge |
0;; |
| Chinese Abstracts Citation Links |
|
| CiteXplore Citation Links |
|
| Definition |
A trihydroxyflavone that is flavone substituted by hydroxy groups at positions 4', 5 and 7.;; |
| DrugBank Database Links |
|
| Formulae |
C15H10O5;; |
| Gmelin Registry Numbers |
|
| INN |
|
| IUPAC Names |
5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one;; |
| InChI |
InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H;; |
| InChIKey |
KZNIFHPLKGYRTM-UHFFFAOYSA-N;; |
| IntAct Database Links |
|
| IntEnz Database Links |
|
| KEGG COMPOUND Database Links |
|
| KEGG DRUG Database Links |
|
| KEGG GLYCAN Database Links |
|
| LIPID MAPS class Database Links |
|
| LIPID MAPS instance Database Links |
LMPK12110005;; |
| Last Modified |
25 Feb 2016;; |
| Mass |
270.23690;; |
| MolBase Database Links |
|
| PDBeChem Database Links |
AGI;; |
| Patent Database Links |
WO2007135592;;WO2007131767;;WO2007130777;;WO2007103555;;WO2007103427;;WO2007097940;;WO2006121518;;WO2005020981;;US2008262080;;US2007232698;;US2007224296;;US2007212393;;US2007202195;;US2007191330;;US2007184133;;US2006135585;;US2002048798;;EP1925311;;EP1911 |
| PubChem Database Links |
8143786;; |
| PubMed Central Citation Links |
|
| PubMed Citation Links |
23359392;;23354402;;23344191;;23304222;;16982614;;16844095;;16648565;;16407641;; |
| RESID Database Links |
|
| Reactome Database Links |
|
| Rhea Database Links |
|
| SABIO-RK Database Links |
3354;;1758;;12345;; |
| SMILES |
Oc1ccc(cc1)-c1cc(=O)c2c(O)cc(O)cc2o1;; |
| Secondary ChEBI ID |
CHEBI:22588;;CHEBI:2768;;CHEBI:12084;; |
| Star |
3;; |
| Synonyms |
versulin;;spigenin;;chamomile;;C.I. Natural Yellow 1;;Apigenol;;5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one;;5,7-dihydroxy-2-(4-hydroxyphenyl)-4-benzopyrone;;5,7-Dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one;;4,5, 7-Trihydroxyflavone;;4',5,7- |
| UM-BBD compID Database Links |
|
| UniProt Database Links |
Q9XGP7;;Q9M1V2;;Q9LRC8;;Q9H227;;Q94C57;;Q8VWZ7;;Q7XZQ8;;Q7F8T6;;Q76MR7;;Q42653;;Q38J50;;P59049;;I6QSN0;;C6TAY1;;B1P123;;A6XNC6;;A6BM07;; |
| ChEBI Image |
 |
| |
|