| Number |
qtl-m0042 |
| Declustering Potential(DP) |
40 |
| Collision Energy(CE) |
30 |
| Observed mass(Da) |
221.0922 |
| Exact mass(Da) |
221.0921 |
| Accurate mass error(ppm) |
0.14 |
| Molecular formula |
C11H12N2O3 |
| Ionization model |
|
| Ret. Time(min) |
|
| Precursor ions(Q1) |
221.1 |
| Product ions(Q3) |
158.4 |
| Main fragments |
158.4, 175.3, 130.1, 104.0 |
| Compound |
5-Hydroxy-L-tryptophan |
| Identification |
putative |
| class |
Amino acid |
| Organism |
|
| Reference |
Harborne et. al (2007) |
| CV(%) |
|
| H2 |
|
| ChEBI_ID |
CHEBI:17780 |
| Agricola Citation Links |
|
| ArrayExpress Database Links |
|
| BRAND Names |
|
| Beilstein Registry Numbers |
88200;; |
| BioModels Database Links |
|
| CAS Registry Numbers |
|
| COMe Database Links |
|
| ChEBI ID |
|
| ChEBI Name |
5-hydroxy-L-tryptophan;; |
| Charge |
0;; |
| Chinese Abstracts Citation Links |
|
| CiteXplore Citation Links |
|
| Definition |
The L-enantiomer of 5-hydroxytryptophan.;; |
| DrugBank Database Links |
DB02959;; |
| Formulae |
C11H12N2O3;; |
| Gmelin Registry Numbers |
1862149;; |
| INN |
|
| IUPAC Names |
5-hydroxy-L-tryptophan;;(2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid;; |
| InChI |
InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16)/t9-/m0/s1;; |
| InChIKey |
LDCYZAJDBXYCGN-VIFPVBQESA-N;; |
| IntAct Database Links |
|
| IntEnz Database Links |
|
| KEGG COMPOUND Database Links |
|
| KEGG DRUG Database Links |
D07339 |
| KEGG GLYCAN Database Links |
|
| LIPID MAPS class Database Links |
|
| LIPID MAPS instance Database Links |
|
| Last Modified |
27 Jan 2016;; |
| Mass |
220.22466;; |
| MolBase Database Links |
|
| PDBeChem Database Links |
|
| Patent Database Links |
|
| PubChem Database Links |
8144010;; |
| PubMed Central Citation Links |
|
| PubMed Citation Links |
9727088;;9295177;;8795441;;8287650;;7733839;;6997735;;6983619;;6182005;;6175178;;5297581;;39668;;3913752;;24369991;;24321061;;22964922;;2193835;;19309105;;19212411;;18445233;;17240182;;16023217;;15893130;;11910264;;11869656;;11486900;;1088369;; |
| RESID Database Links |
|
| Reactome Database Links |
R-HSA-209859;;R-HSA-209828;; |
| Rhea Database Links |
|
| SABIO-RK Database Links |
8593;;7181;;2595;;1900;; |
| SMILES |
N[C@@H](Cc1c[nH]c2ccc(O)cc12)C(O)=O;; |
| Secondary ChEBI ID |
CHEBI:20577;;CHEBI:2064;;CHEBI:12133;; |
| Star |
3;; |
| Synonyms |
oxitriptan;;Triptene;;Tript-OH;;Telesol;;Serotonyl;;Quietim;;Pretonine;;Oxytryptophan;;Oxyfan;;Oxitriptan;;Levotinine;;Levothym;;L-5-hydroxytryptophan;;Hydroxytryptophan;;Cincofarm;;5-hydroxytryptophan L-form;;5-Hydroxytryptophan L form;;5-Hydroxytryptoph |
| UM-BBD compID Database Links |
|
| UniProt Database Links |
Q92142;;Q8IWU9;;Q8CGV2;;Q8CGU9;;Q54XS1;;Q2HZ26;;Q0EAB8;;P80041;;P70080;;P54771;;P54770;;P54769;;P54768;;P48861;;P34751;;P27718;;P22781;;P20711;;P17770;;P17752;;P17532;;P17290;;P17276;;P14173;;P09810;;P05031;;O96571;;O96567;;O88533;; |
| ChEBI Image |
 |
| |
|
