| Number |
mr1440 |
| Declustering Potential(DP) |
50 |
| Collision Energy(CE) |
30 |
| Observed mass(Da) |
287.0544 |
| Exact mass(Da) |
287.0550 |
| Accurate mass error(ppm) |
2.15 |
| Molecular formula |
C15H10O6 |
| Ionization model |
|
| Ret. Time(min) |
10.60 |
| Precursor ions(Q1) |
287.0544 |
| Product ions(Q3) |
153.0 |
| Main fragments |
153.0, 135.0 |
| Compound |
Luteolin |
| Identification |
standard |
| class |
Flavonoid |
| Organism |
|
| Reference |
|
| CV(%) |
98.94 |
| H2 |
0.30 |
| ChEBI_ID |
CHEBI:15864 |
| Agricola Citation Links |
|
| ArrayExpress Database Links |
|
| BRAND Names |
|
| Beilstein Registry Numbers |
|
| BioModels Database Links |
|
| CAS Registry Numbers |
|
| COMe Database Links |
|
| ChEBI ID |
|
| ChEBI Name |
luteolin;; |
| Charge |
0;; |
| Chinese Abstracts Citation Links |
|
| CiteXplore Citation Links |
|
| Definition |
A 3'-hydroxyflavonoid which is thought to play an important role in the human body as an antioxidant, a free radical scavenger, an agent in the prevention of inflammation, a promoter of carbohydrate metabolism, and an immune system modulator.;; |
| DrugBank Database Links |
|
| Formulae |
C15H10O6;; |
| Gmelin Registry Numbers |
|
| INN |
|
| IUPAC Names |
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one;; |
| InChI |
InChI=1S/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H;; |
| InChIKey |
IQPNAANSBPBGFQ-UHFFFAOYSA-N;; |
| IntAct Database Links |
|
| IntEnz Database Links |
|
| KEGG COMPOUND Database Links |
|
| KEGG DRUG Database Links |
|
| KEGG GLYCAN Database Links |
|
| LIPID MAPS class Database Links |
|
| LIPID MAPS instance Database Links |
LMPK12110006;; |
| Last Modified |
25 Feb 2016;; |
| Mass |
286.23630;; |
| MolBase Database Links |
|
| PDBeChem Database Links |
|
| Patent Database Links |
WO2007131767;;WO2007130882;;WO2007130777;;WO2007103555;;WO2007098873;;WO2005020981;;US2007224296;;US2007212395;;US2007202195;;US2007191330;;US2007184133;;EP1932517;;EP1925311;;EP1808172;;EP1808169;;EP1600061;; |
| PubChem Database Links |
8145650;; |
| PubMed Central Citation Links |
|
| PubMed Citation Links |
23229294;;23035972;;22749133;;21899269;;18991571;;18946424;; |
| RESID Database Links |
|
| Reactome Database Links |
|
| Rhea Database Links |
|
| SABIO-RK Database Links |
3310;;13062;;12356;;12355;; |
| SMILES |
Oc1cc(O)c2c(c1)oc(cc2=O)-c1ccc(O)c(O)c1;; |
| Secondary ChEBI ID |
CHEBI:25086;;CHEBI:6578;;CHEBI:14536;;CHEBI:12082;; |
| Star |
3;; |
| Synonyms |
flacitran;;digitoflavone;;Salifazide;;Luteolol;;2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one;;2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-benzopyrone;; |
| UM-BBD compID Database Links |
|
| UniProt Database Links |
Q9XGP7;;Q9LRC8;;Q9H227;;Q94C57;;Q84N28;;Q7GB25;;Q7F8T6;;Q76MR7;;Q6ZD89;;Q42653;;Q38J50;;P93149;;P59049;;P25195;;P0AEK4;; |
| ChEBI Image |
 |
| |
|
