Number |
mr1346 |
Declustering Potential(DP) |
30 |
Collision Energy(CE) |
20 |
Observed mass(Da) |
|
Exact mass(Da) |
|
Accurate mass error(ppm) |
|
Molecular formula |
|
Ionization model |
|
Ret. Time(min) |
4.95 |
Precursor ions(Q1) |
205.2 |
Product ions(Q3) |
146.2 |
Main fragments |
146.2, 118.1, 170.3, 188.2, 91.0 |
Compound |
L-Tryptophan |
Identification |
standard |
class |
Amino acid |
Organism |
|
Reference |
|
CV(%) |
57.12 |
H2 |
0.44 |
ChEBI_ID |
CHEBI:32712 |
Agricola Citation Links |
|
ArrayExpress Database Links |
|
BRAND Names |
|
Beilstein Registry Numbers |
6334208;; |
BioModels Database Links |
|
CAS Registry Numbers |
|
COMe Database Links |
|
ChEBI ID |
|
ChEBI Name |
L-tryptophanyl radical;; |
Charge |
0;; |
Chinese Abstracts Citation Links |
|
CiteXplore Citation Links |
|
Definition |
The L-enantiomer of tryptophanyl radical.;; |
DrugBank Database Links |
|
Formulae |
C11H11N2O2;; |
Gmelin Registry Numbers |
|
INN |
|
IUPAC Names |
3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-1-yl;; |
InChI |
InChI=1S/C11H11N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9H,5,12H2,(H,14,15)/t9-/m0/s1;; |
InChIKey |
UMQXPTSGLUXAQK-VIFPVBQESA-N;; |
IntAct Database Links |
|
IntEnz Database Links |
|
KEGG COMPOUND Database Links |
|
KEGG DRUG Database Links |
|
KEGG GLYCAN Database Links |
|
LIPID MAPS class Database Links |
|
LIPID MAPS instance Database Links |
|
Last Modified |
09 Jul 2014;; |
Mass |
203.21732;; |
MolBase Database Links |
|
PDBeChem Database Links |
|
Patent Database Links |
|
PubChem Database Links |
8147525;; |
PubMed Central Citation Links |
|
PubMed Citation Links |
|
RESID Database Links |
|
Reactome Database Links |
|
Rhea Database Links |
|
SABIO-RK Database Links |
|
SMILES |
N[C@@H](Cc1c[n]c2ccccc12)C(O)=O;; |
Secondary ChEBI ID |
|
Star |
3;; |
Synonyms |
L-tryptophan(.);;L-tryptophan radical;; |
UM-BBD compID Database Links |
|
UniProt Database Links |
|
ChEBI Image |
 |
|
|