Number |
mr1622 |
Declustering Potential(DP) |
50 |
Collision Energy(CE) |
20 |
Observed mass(Da) |
|
Exact mass(Da) |
|
Accurate mass error(ppm) |
|
Molecular formula |
|
Ionization model |
|
Ret. Time(min) |
8.05 |
Precursor ions(Q1) |
165.2 |
Product ions(Q3) |
147.0 |
Main fragments |
147.0, 119.0, 65.1, 66.9 |
Compound |
4-Coumaric acid |
Identification |
standard |
class |
Ployphenol |
Organism |
|
Reference |
|
CV(%) |
56.22 |
H2 |
0.57 |
ChEBI_ID |
CHEBI:36090 |
Agricola Citation Links |
|
ArrayExpress Database Links |
|
BRAND Names |
|
Beilstein Registry Numbers |
2207381;; |
BioModels Database Links |
|
CAS Registry Numbers |
7400-08-0;; |
COMe Database Links |
|
ChEBI ID |
|
ChEBI Name |
4-coumaric acid;; |
Charge |
0;; |
Chinese Abstracts Citation Links |
|
CiteXplore Citation Links |
|
Definition |
A coumaric acid in which the hydroxy substituent is located at C-4 of the phenyl ring.;; |
DrugBank Database Links |
|
Formulae |
C9H8O3;; |
Gmelin Registry Numbers |
|
INN |
|
IUPAC Names |
3-(4-hydroxyphenyl)prop-2-enoic acid;; |
InChI |
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12);; |
InChIKey |
NGSWKAQJJWESNS-UHFFFAOYSA-N;; |
IntAct Database Links |
|
IntEnz Database Links |
|
KEGG COMPOUND Database Links |
|
KEGG DRUG Database Links |
|
KEGG GLYCAN Database Links |
|
LIPID MAPS class Database Links |
|
LIPID MAPS instance Database Links |
|
Last Modified |
19 Jun 2014;; |
Mass |
164.15802;; |
MolBase Database Links |
|
PDBeChem Database Links |
|
Patent Database Links |
WO2007109600;;WO2007098022;;WO2006097811;;WO2005030695;;US2007183996;;US2007142472;;US2007010579;;US2006270608;;US2006166981;;US2006073223;;US2004171682;;US2004023890;;US2003199566;;US2003070188;;US2001053789;;US2001039035;;EP1985191;;EP1568283;;EP1533355 |
PubChem Database Links |
17425116;; |
PubMed Central Citation Links |
|
PubMed Citation Links |
7285584;;24927550;;23892112;;23857900;;23810795;;23684599;;23669407;;23485470;;23420453;;23178520;;22923003;;22585412;;22447332;;19930809;;19089825;;11684179;; |
RESID Database Links |
|
Reactome Database Links |
|
Rhea Database Links |
|
SABIO-RK Database Links |
7120;;2808;;2223;;1761;;13552;;1100;;1076;; |
SMILES |
[H]C(=Cc1ccc(O)cc1)C(O)=O;; |
Secondary ChEBI ID |
CHEBI:20405;;CHEBI:20348;; |
Star |
3;; |
Synonyms |
para-coumaric acid;;p-hydroxyphenylacrylic acid;;p-hydroxycinnamic acid;;p-coumaric acid;;beta-[4-hydroxyphenyl]acrylic acid;;4-hydroxycinnamic acid;;4-coumaric acid;;4'-hydroxycinnamic acid;;3-(4-hydroxyphenyl)acrylic acid;;3-(4-hydroxyphenyl)-2-propenoi |
UM-BBD compID Database Links |
|
UniProt Database Links |
Q9LHN8;;Q9C899;;Q8WZI8;;Q8W1W9;;Q8VXG7;;Q8VWZ7;;Q66PF4;;Q53226;;Q53120;;Q03034;;P84516;;P81046;;P42516;;P33751;;P16113;;P11544;;O69140;;O69138;;O54075;;G2QND5;;C0SJS3;;A8QW51;; |
ChEBI Image |
|
|
|