| Number |
mr1346 |
| Declustering Potential(DP) |
30 |
| Collision Energy(CE) |
20 |
| Observed mass(Da) |
|
| Exact mass(Da) |
|
| Accurate mass error(ppm) |
|
| Molecular formula |
|
| Ionization model |
|
| Ret. Time(min) |
4.95 |
| Precursor ions(Q1) |
205.2 |
| Product ions(Q3) |
146.2 |
| Main fragments |
146.2, 118.1, 170.3, 188.2, 91.0 |
| Compound |
L-Tryptophan |
| Identification |
standard |
| class |
Amino acid |
| Organism |
|
| Reference |
|
| CV(%) |
57.12 |
| H2 |
0.44 |
| ChEBI_ID |
CHEBI:32712 |
| Agricola Citation Links |
|
| ArrayExpress Database Links |
|
| BRAND Names |
|
| Beilstein Registry Numbers |
6334208;; |
| BioModels Database Links |
|
| CAS Registry Numbers |
|
| COMe Database Links |
|
| ChEBI ID |
|
| ChEBI Name |
L-tryptophanyl radical;; |
| Charge |
0;; |
| Chinese Abstracts Citation Links |
|
| CiteXplore Citation Links |
|
| Definition |
The L-enantiomer of tryptophanyl radical.;; |
| DrugBank Database Links |
|
| Formulae |
C11H11N2O2;; |
| Gmelin Registry Numbers |
|
| INN |
|
| IUPAC Names |
3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-1-yl;; |
| InChI |
InChI=1S/C11H11N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9H,5,12H2,(H,14,15)/t9-/m0/s1;; |
| InChIKey |
UMQXPTSGLUXAQK-VIFPVBQESA-N;; |
| IntAct Database Links |
|
| IntEnz Database Links |
|
| KEGG COMPOUND Database Links |
|
| KEGG DRUG Database Links |
|
| KEGG GLYCAN Database Links |
|
| LIPID MAPS class Database Links |
|
| LIPID MAPS instance Database Links |
|
| Last Modified |
09 Jul 2014;; |
| Mass |
203.21732;; |
| MolBase Database Links |
|
| PDBeChem Database Links |
|
| Patent Database Links |
|
| PubChem Database Links |
8147525;; |
| PubMed Central Citation Links |
|
| PubMed Citation Links |
|
| RESID Database Links |
|
| Reactome Database Links |
|
| Rhea Database Links |
|
| SABIO-RK Database Links |
|
| SMILES |
N[C@@H](Cc1c[n]c2ccccc12)C(O)=O;; |
| Secondary ChEBI ID |
|
| Star |
3;; |
| Synonyms |
L-tryptophan(.);;L-tryptophan radical;; |
| UM-BBD compID Database Links |
|
| UniProt Database Links |
|
| ChEBI Image |
 |
| |
|
