| Number |
mr1193 |
| Declustering Potential(DP) |
60 |
| Collision Energy(CE) |
20 |
| Observed mass(Da) |
312.1305 |
| Exact mass(Da) |
312.1302 |
| Accurate mass error(ppm) |
0.82 |
| Molecular formula |
C12H17N5O5 |
| Ionization model |
|
| Ret. Time(min) |
4.73 |
| Precursor ions(Q1) |
312.1305 |
| Product ions(Q3) |
180.2 |
| Main fragments |
180.2, 222.2, 135.1, 110.1 |
| Compound |
N2, N2-Dimethylguanosine |
| Identification |
putative |
| class |
Nucleic acid derivative |
| Organism |
Homo sapiens |
| Reference |
Bernd et. al (2005) |
| CV(%) |
62.04 |
| H2 |
0.50 |
| ChEBI_ID |
CHEBI:19289 |
| Agricola Citation Links |
|
| ArrayExpress Database Links |
|
| BRAND Names |
|
| Beilstein Registry Numbers |
47545;; |
| BioModels Database Links |
|
| CAS Registry Numbers |
2140-67-2;; |
| COMe Database Links |
|
| ChEBI ID |
|
| ChEBI Name |
N(2),N(2)-dimethylguanosine;; |
| Charge |
0;; |
| Chinese Abstracts Citation Links |
|
| CiteXplore Citation Links |
|
| Definition |
A guanosine where the hydrogens of the amine group at C-2 are substituted by methyl groups.;; |
| DrugBank Database Links |
|
| Formulae |
C12H17N5O5;; |
| Gmelin Registry Numbers |
|
| INN |
|
| IUPAC Names |
N,N-dimethylguanosine;; |
| InChI |
InChI=1S/C12H17N5O5/c1-16(2)12-14-9-6(10(21)15-12)13-4-17(9)11-8(20)7(19)5(3-18)22-11/h4-5,7-8,11,18-20H,3H2,1-2H3,(H,14,15,21)/t5-,7-,8-,11-/m1/s1;; |
| InChIKey |
RSPURTUNRHNVGF-IOSLPCCCSA-N;; |
| IntAct Database Links |
|
| IntEnz Database Links |
|
| KEGG COMPOUND Database Links |
|
| KEGG DRUG Database Links |
|
| KEGG GLYCAN Database Links |
|
| LIPID MAPS class Database Links |
|
| LIPID MAPS instance Database Links |
|
| Last Modified |
23 Oct 2015;; |
| Mass |
311.29408;; |
| MolBase Database Links |
|
| PDBeChem Database Links |
|
| Patent Database Links |
|
| PubChem Database Links |
53801190;; |
| PubMed Central Citation Links |
|
| PubMed Citation Links |
2437827;;22770225;;15991285;;15116424;; |
| RESID Database Links |
|
| Reactome Database Links |
|
| Rhea Database Links |
|
| SABIO-RK Database Links |
|
| SMILES |
CN(C)c1nc2n(cnc2c(=O)[nH]1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O;; |
| Secondary ChEBI ID |
|
| Star |
3;; |
| Synonyms |
m22g;;N2-Dimethylguanosine;;N,N-Dimethyl-Guanosine;;N,N- Dimethylguanosine;;N(2),N(2)-Dimethylguanosine;;9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(dimethylamino)-6,9-dihydro-3H-purin-6-one;;2-Dimethylamino-6-oxypurine riboside;;2-(di |
| UM-BBD compID Database Links |
|
| UniProt Database Links |
Q9UY84;;Q58120;;P05409;;O29011;;O26820;; |
| ChEBI Image |
 |
| |
|
