Number |
mr1161 |
Declustering Potential(DP) |
50 |
Collision Energy(CE) |
30 |
Observed mass(Da) |
|
Exact mass(Da) |
|
Accurate mass error(ppm) |
|
Molecular formula |
|
Ionization model |
|
Ret. Time(min) |
5.93 |
Precursor ions(Q1) |
355.1 |
Product ions(Q3) |
163.0 |
Main fragments |
163.0 |
Compound |
Chlorogenic acid |
Identification |
standard |
class |
Ployphenol |
Organism |
|
Reference |
|
CV(%) |
210.33 |
H2 |
0.84 |
ChEBI_ID |
CHEBI:16112 |
Agricola Citation Links |
|
ArrayExpress Database Links |
|
BRAND Names |
|
Beilstein Registry Numbers |
|
BioModels Database Links |
|
CAS Registry Numbers |
|
COMe Database Links |
|
ChEBI ID |
|
ChEBI Name |
chlorogenic acid;; |
Charge |
0;; |
Chinese Abstracts Citation Links |
|
CiteXplore Citation Links |
|
Definition |
A cinnamate ester obtained by formal condensation of the carboxy group of trans-caffeic acid with the 3-hydroxy group of quinic acid. It is an intermediate metabolite in the biosynthesis of lignin.;; |
DrugBank Database Links |
|
Formulae |
C16H18O9;; |
Gmelin Registry Numbers |
|
INN |
|
IUPAC Names |
edit(1S,3R,4R,5R)-3-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4,5-trihydroxycyclohexane-1-carboxylic acid;; |
InChI |
InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1;; |
InChIKey |
CWVRJTMFETXNAD-JUHZACGLSA-N;; |
IntAct Database Links |
|
IntEnz Database Links |
|
KEGG COMPOUND Database Links |
|
KEGG DRUG Database Links |
|
KEGG GLYCAN Database Links |
|
LIPID MAPS class Database Links |
|
LIPID MAPS instance Database Links |
|
Last Modified |
08 Jan 2016;; |
Mass |
354.30870;; |
MolBase Database Links |
|
PDBeChem Database Links |
|
Patent Database Links |
WO2007131106;;WO2007096643;;US2008233242;;US2007293577;;US2007270497;;US2007231371;;US2007207228;;US2007196381;;US2007190050;;US2007184133;;US2007184114;;US2007178176;;US2006240077;;US2006073223;;US2004224906;;US2004213881;;US2003211184;;US2003149097;;US2 |
PubChem Database Links |
8144862;; |
PubMed Central Citation Links |
|
PubMed Citation Links |
8070737;;22770225;;17368041;;16869989;;16614403;;16507475;;15374625;;15309458;;14666669;;12771329;;12771321;;11439108;;11308321;;10412494;; |
RESID Database Links |
|
Reactome Database Links |
|
Rhea Database Links |
|
SABIO-RK Database Links |
|
SMILES |
O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\c2ccc(O)c(O)c2)[C@@H]1O)C(O)=O;; |
Secondary ChEBI ID |
CHEBI:23145;;CHEBI:13972;;CHEBI:3625;; |
Star |
3;; |
Synonyms |
trans-5-O-Caffeoyl-D-quinate;;Hlorogenic acid;;Hlorogenate;;Heriguard;;Chlorogenate;;Caffeoyl quinic acid;;5-O-(3,4-Dihydroxycinnamoyl)-L-quinic acid;;3-trans-Caffeoylquinic acid;;3-O-Caffeoylquinic acid;;3-Caffeoylquinic acid;;3-Caffeoylquinate;;3-(3,4-D |
UM-BBD compID Database Links |
|
UniProt Database Links |
Q9C9W4;;Q38J50;; |
ChEBI Image |
 |
|
|